ibmkab2009 ibmkab2009

01-07-2020
Mathematics

contestada

what can farmers do to protect his grains after harvesting
pls answer pls
it is important

Respuesta :

Alphaboi Alphaboi

01-07-2020

Answer:

just put the grains in a bag in a storeroom

Answer Link

Otras preguntas

when graphing a linear function in slope intercept form , why do you have to plot the y-intercept first? why cant you use the slope first

What times 4 minus 2 divided by 30 equals 68

Find the three angles of a triangle if the sum of the first angle and twice the second equals the third and, and if four times the second angle is 15 degrees mo

Your large firm is about to change to a customer centered organization structure in which employees who have rarely had customer contact will now likely signifi

Write an equation of the line containing the given point and parallel to given line. Express your answer in the form y=mx+b (6,8); x+5y=2

In which quadrant does the point (16, 21) lie?

cosec(6b+pi/8)=sec(2b-pi/8)

What is Intaglio in printmaking?

Jessica must choose a number between 67 and 113 that is a multiple of 4, 9, and 12. Write all the numbers that she could choose. If there is more than one numb

Can any one help me on these two please