dachelys9 dachelys9

02-08-2019
Mathematics

contestada

What is the solution to this system of linear equations?

What is the solution to this system of linear equations class=

Respuesta :

kosala1478 kosala1478

02-08-2019

Answer:

4th

Step-by-step explanation:

(-1,3)

here is the answer

Ver imagen kosala1478

Answer Link

Otras preguntas

If y is inversely proportional to x and y = 15 when x= 3 Find x when y = 5. X=5 X=8 X=9 X=1

Looking at the misty rain and fog, explain at least two defensive driving techniques you would utilize to adjust your driving and lower your risk

12. What group of organisms are most in danger of extinction? those with small populations both a and b those with large populations that breed quickly those th

If the initial amount of iodine-131 is 537 grams , how much is left after 10 days?

How does this image enhance the information providedin the book?o It connects the book's central ideas about bicycleinnovators.It offers an example of how the A

17A pipe can fill a tankin h hours. What part of the tank isfilled in x hours.a) hxb)h/x c) x/hd) h + x

Due to the side-effects of industrialization, Roosevelt passed many conservation efforts, such as: A. The 17th Amendment B. The Sierra Club C. The Federal Emplo

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

Simplify the slope of bd

In comparing two distributions, which attribute would you not compare? A. Shape B. Center C. Marginal frequency D. Spread